About 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine
1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine (PubChem CID 107083250) has the molecular formula C16H22BrF2N
and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine.
Molecular Properties
| Compound Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine |
| PubChem CID | 107083250 |
| Molecular Formula | C16H22BrF2N |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine |
| SMILES | CCC1(CC)CCN(c2c(F)cc(CBr)cc2F)CC1 |
| InChI | InChI=1S/C16H22BrF2N/c1-3-16(4-2)5-7-20(8-6-16)15-13(18)9-12(11-17)10-14(15)19/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | WJOUUOWWMSBJJE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine?
The IUPAC name of 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine (CID 107083250) is 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine.
What is the SMILES notation for 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine?
The canonical SMILES for 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine is CCC1(CC)CCN(c2c(F)cc(CBr)cc2F)CC1.
What is the InChIKey of 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine?
The InChIKey is WJOUUOWWMSBJJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrF2N/c1-3-16(4-2)5-7-20(8-6-16)15-13(18)9-12(11-17)10-14(15)19/h9-10H,3-8,11H2,1-2H3.
What are the key properties of 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine?
1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine has a molecular weight of 346.26 g/mol, XLogP of 5.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(bromomethyl)-2,6-difluorophenyl]-4,4-diethylpiperidine is sourced from PubChem (CID 107083250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).