C11H13Cl2FN2 — CID 83081604
1-(2,6-dichloro-4-fluorophenyl)-3-methylpiperazine (PubChem CID 83081604) has the molecular formula C11H13Cl2FN2 and a molecular weight of 263.14 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-fluorophenyl)-3-methylpiperazine.
| Compound Name | 1-(2,6-dichloro-4-fluorophenyl)-3-methylpiperazine |
|---|---|
| PubChem CID | 83081604 |
| Molecular Formula | C11H13Cl2FN2 |
| Molecular Weight | 263.14 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(2,6-dichloro-4-fluorophenyl)-3-methylpiperazine |
| SMILES | CC1CN(c2c(Cl)cc(F)cc2Cl)CCN1 |
| InChI | InChI=1S/C11H13Cl2FN2/c1-7-6-16(3-2-15-7)11-9(12)4-8(14)5-10(11)13/h4-5,7,15H,2-3,6H2,1H3 |
| InChIKey | POOLCTIEMZDJOV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |