About 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane
3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane (PubChem CID 83081680) has the molecular formula C14H17Cl2FN2
and a molecular weight of 303.21 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane |
| PubChem CID | 83081680 |
| Molecular Formula | C14H17Cl2FN2 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane |
| SMILES | Fc1cc(Cl)c(N2CCCNC(C3CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2FN2/c15-11-6-10(17)7-12(16)14(11)19-5-1-4-18-13(8-19)9-2-3-9/h6-7,9,13,18H,1-5,8H2 |
| InChIKey | KIKXVRQLVHPSJD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane?
The IUPAC name of 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane (CID 83081680) is 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane.
What is the SMILES notation for 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane?
The canonical SMILES for 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane is Fc1cc(Cl)c(N2CCCNC(C3CC3)C2)c(Cl)c1.
What is the InChIKey of 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane?
The InChIKey is KIKXVRQLVHPSJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2FN2/c15-11-6-10(17)7-12(16)14(11)19-5-1-4-18-13(8-19)9-2-3-9/h6-7,9,13,18H,1-5,8H2.
What are the key properties of 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane?
3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane has a molecular weight of 303.21 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane is sourced from PubChem (CID 83081680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).