C14H17Cl2FN2 — CID 83081680
3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane (PubChem CID 83081680) has the molecular formula C14H17Cl2FN2 and a molecular weight of 303.21 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane.
| Compound Name | 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 83081680 |
| Molecular Formula | C14H17Cl2FN2 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-cyclopropyl-1-(2,6-dichloro-4-fluorophenyl)-1,4-diazepane |
| SMILES | Fc1cc(Cl)c(N2CCCNC(C3CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2FN2/c15-11-6-10(17)7-12(16)14(11)19-5-1-4-18-13(8-19)9-2-3-9/h6-7,9,13,18H,1-5,8H2 |
| InChIKey | KIKXVRQLVHPSJD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |