C14H17BrF2N2 — CID 64945171
1-(2-bromo-4,6-difluorophenyl)-3-cyclopropyl-1,4-diazepane (PubChem CID 64945171) has the molecular formula C14H17BrF2N2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3-cyclopropyl-1,4-diazepane.
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3-cyclopropyl-1,4-diazepane |
|---|---|
| PubChem CID | 64945171 |
| Molecular Formula | C14H17BrF2N2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3-cyclopropyl-1,4-diazepane |
| SMILES | Fc1cc(F)c(N2CCCNC(C3CC3)C2)c(Br)c1 |
| InChI | InChI=1S/C14H17BrF2N2/c15-11-6-10(16)7-12(17)14(11)19-5-1-4-18-13(8-19)9-2-3-9/h6-7,9,13,18H,1-5,8H2 |
| InChIKey | UDHFVVKFJLGZSC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |