C15H18ClF3N2 — CID 64945131
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyclopropyl-1,4-diazepane (PubChem CID 64945131) has the molecular formula C15H18ClF3N2 and a molecular weight of 318.77 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyclopropyl-1,4-diazepane.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyclopropyl-1,4-diazepane |
|---|---|
| PubChem CID | 64945131 |
| Molecular Formula | C15H18ClF3N2 |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-cyclopropyl-1,4-diazepane |
| SMILES | FC(F)(F)c1cc(N2CCCNC(C3CC3)C2)ccc1Cl |
| InChI | InChI=1S/C15H18ClF3N2/c16-13-5-4-11(8-12(13)15(17,18)19)21-7-1-6-20-14(9-21)10-2-3-10/h4-5,8,10,14,20H,1-3,6-7,9H2 |
| InChIKey | MMBAXSFGEIRAJB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |