C13H13ClF3NO2S — CID 58466045
2-[1-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylacetic acid (PubChem CID 58466045) has the molecular formula C13H13ClF3NO2S and a molecular weight of 339.77 g/mol. Its IUPAC name is 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 58466045 |
| Molecular Formula | C13H13ClF3NO2S |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-[1-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSC1CCN(c2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H13ClF3NO2S/c14-11-2-1-8(5-10(11)13(15,16)17)18-4-3-9(6-18)21-7-12(19)20/h1-2,5,9H,3-4,6-7H2,(H,19,20) |
| InChIKey | MFEALMJCCPRKOC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |