C18H22ClF3N2O — CID 113080057
[4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-cyclohexylmethanone (PubChem CID 113080057) has the molecular formula C18H22ClF3N2O and a molecular weight of 374.83 g/mol. Its IUPAC name is [4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-cyclohexylmethanone.
| Compound Name | [4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 113080057 |
| Molecular Formula | C18H22ClF3N2O |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [4-[4-chloro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1CCN(c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H22ClF3N2O/c19-16-7-6-14(12-15(16)18(20,21)22)23-8-10-24(11-9-23)17(25)13-4-2-1-3-5-13/h6-7,12-13H,1-5,8-11H2 |
| InChIKey | RLNVRMVCCQAMLE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |