C15H14ClNO — CID 28945727
[2-chloro-6-(2,3-dihydroindol-1-yl)phenyl]methanol (PubChem CID 28945727) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is [2-chloro-6-(2,3-dihydroindol-1-yl)phenyl]methanol.
| Compound Name | [2-chloro-6-(2,3-dihydroindol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 28945727 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [2-chloro-6-(2,3-dihydroindol-1-yl)phenyl]methanol |
| SMILES | OCc1c(Cl)cccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C15H14ClNO/c16-13-5-3-7-15(12(13)10-18)17-9-8-11-4-1-2-6-14(11)17/h1-7,18H,8-10H2 |
| InChIKey | TUNGDOLWEUJFSV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |