C17H19ClN2 — CID 81149063
N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine (PubChem CID 81149063) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine.
| Compound Name | N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 81149063 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(N2CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClN2/c1-2-19-12-13-7-8-17(15(18)11-13)20-10-9-14-5-3-4-6-16(14)20/h3-8,11,19H,2,9-10,12H2,1H3 |
| InChIKey | WWOUVMNFZDCVTM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |