About N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine
N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine (PubChem CID 81149063) has the molecular formula C17H19ClN2
and a molecular weight of 286.81 g/mol. Its IUPAC name is N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine |
| PubChem CID | 81149063 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(N2CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClN2/c1-2-19-12-13-7-8-17(15(18)11-13)20-10-9-14-5-3-4-6-16(14)20/h3-8,11,19H,2,9-10,12H2,1H3 |
| InChIKey | WWOUVMNFZDCVTM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine?
The IUPAC name of N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine (CID 81149063) is N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine.
What is the SMILES notation for N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine?
The canonical SMILES for N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine is CCNCc1ccc(N2CCc3ccccc32)c(Cl)c1.
What is the InChIKey of N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine?
The InChIKey is WWOUVMNFZDCVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2/c1-2-19-12-13-7-8-17(15(18)11-13)20-10-9-14-5-3-4-6-16(14)20/h3-8,11,19H,2,9-10,12H2,1H3.
What are the key properties of N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine?
N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine has a molecular weight of 286.81 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-chloro-4-(2,3-dihydroindol-1-yl)phenyl]methyl]ethanamine is sourced from PubChem (CID 81149063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).