About N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine
N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine (PubChem CID 81148572) has the molecular formula C16H25ClN2
and a molecular weight of 280.84 g/mol. Its IUPAC name is N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine |
| PubChem CID | 81148572 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(N2CCCC(C)C2C)c(Cl)c1 |
| InChI | InChI=1S/C16H25ClN2/c1-4-18-11-14-7-8-16(15(17)10-14)19-9-5-6-12(2)13(19)3/h7-8,10,12-13,18H,4-6,9,11H2,1-3H3 |
| InChIKey | RUISACOJBDHXQX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine?
The IUPAC name of N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine (CID 81148572) is N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine.
What is the SMILES notation for N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine?
The canonical SMILES for N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine is CCNCc1ccc(N2CCCC(C)C2C)c(Cl)c1.
What is the InChIKey of N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine?
The InChIKey is RUISACOJBDHXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClN2/c1-4-18-11-14-7-8-16(15(17)10-14)19-9-5-6-12(2)13(19)3/h7-8,10,12-13,18H,4-6,9,11H2,1-3H3.
What are the key properties of N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine?
N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine has a molecular weight of 280.84 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-chloro-4-(2,3-dimethylpiperidin-1-yl)phenyl]methyl]ethanamine is sourced from PubChem (CID 81148572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).