C16H25ClN2 — CID 81149011
N-[[3-chloro-4-(2-ethylpyrrolidin-1-yl)phenyl]methyl]propan-2-amine (PubChem CID 81149011) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-ethylpyrrolidin-1-yl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-chloro-4-(2-ethylpyrrolidin-1-yl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 81149011 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-[[3-chloro-4-(2-ethylpyrrolidin-1-yl)phenyl]methyl]propan-2-amine |
| SMILES | CCC1CCCN1c1ccc(CNC(C)C)cc1Cl |
| InChI | InChI=1S/C16H25ClN2/c1-4-14-6-5-9-19(14)16-8-7-13(10-15(16)17)11-18-12(2)3/h7-8,10,12,14,18H,4-6,9,11H2,1-3H3 |
| InChIKey | UUUVYQFBQPPNBC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|