C18H29ClN2 — CID 104690830
N-[[3-chloro-4-(2-ethylazepan-1-yl)phenyl]methyl]propan-1-amine (PubChem CID 104690830) has the molecular formula C18H29ClN2 and a molecular weight of 308.90 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-ethylazepan-1-yl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-chloro-4-(2-ethylazepan-1-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 104690830 |
| Molecular Formula | C18H29ClN2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[[3-chloro-4-(2-ethylazepan-1-yl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(N2CCCCCC2CC)c(Cl)c1 |
| InChI | InChI=1S/C18H29ClN2/c1-3-11-20-14-15-9-10-18(17(19)13-15)21-12-7-5-6-8-16(21)4-2/h9-10,13,16,20H,3-8,11-12,14H2,1-2H3 |
| InChIKey | TZLPGIOEKRNMMO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|