C17H28N2O — CID 84754215
N-[[4-(2-ethylpiperidin-1-yl)-3-methoxyphenyl]methyl]ethanamine (PubChem CID 84754215) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-[[4-(2-ethylpiperidin-1-yl)-3-methoxyphenyl]methyl]ethanamine.
| Compound Name | N-[[4-(2-ethylpiperidin-1-yl)-3-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 84754215 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-[[4-(2-ethylpiperidin-1-yl)-3-methoxyphenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(N2CCCCC2CC)c(OC)c1 |
| InChI | InChI=1S/C17H28N2O/c1-4-15-8-6-7-11-19(15)16-10-9-14(13-18-5-2)12-17(16)20-3/h9-10,12,15,18H,4-8,11,13H2,1-3H3 |
| InChIKey | HAYSUNSHECSICL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|