C15H20ClNO — CID 82750860
[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chlorophenyl]methanol (PubChem CID 82750860) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chlorophenyl]methanol.
| Compound Name | [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chlorophenyl]methanol |
|---|---|
| PubChem CID | 82750860 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-chlorophenyl]methanol |
| SMILES | OCc1c(Cl)cccc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H20ClNO/c16-13-5-3-7-15(12(13)10-18)17-9-8-11-4-1-2-6-14(11)17/h3,5,7,11,14,18H,1-2,4,6,8-10H2 |
| InChIKey | WSCDRADBESOHEI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |