C18H27ClN2 — CID 102727329
N-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-6-chlorophenyl]methyl]ethanamine (PubChem CID 102727329) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is N-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-6-chlorophenyl]methyl]ethanamine.
| Compound Name | N-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-6-chlorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 102727329 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-6-chlorophenyl]methyl]ethanamine |
| SMILES | CCNCc1c(Cl)cccc1N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H27ClN2/c1-2-20-13-15-16(19)9-5-11-18(15)21-12-6-8-14-7-3-4-10-17(14)21/h5,9,11,14,17,20H,2-4,6-8,10,12-13H2,1H3/t14-,17-/m1/s1 |
| InChIKey | BIOABLAFDQYNOA-RHSMWYFYSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |