C15H14ClFN2 — CID 103494043
[2-chloro-6-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanamine (PubChem CID 103494043) has the molecular formula C15H14ClFN2 and a molecular weight of 276.74 g/mol. Its IUPAC name is [2-chloro-6-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanamine.
| Compound Name | [2-chloro-6-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 103494043 |
| Molecular Formula | C15H14ClFN2 |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [2-chloro-6-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanamine |
| SMILES | NCc1c(Cl)cccc1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C15H14ClFN2/c16-13-2-1-3-14(12(13)9-18)19-7-6-10-4-5-11(17)8-15(10)19/h1-5,8H,6-7,9,18H2 |
| InChIKey | IFVSWDXISXYIIB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |