C17H19FN2O — CID 63591839
2-(2,3-dihydroindol-1-yl)-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 63591839) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 63591839 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(N2CCc3ccccc32)c(N)cc1F |
| InChI | InChI=1S/C17H19FN2O/c1-11(2)21-17-10-16(14(19)9-13(17)18)20-8-7-12-5-3-4-6-15(12)20/h3-6,9-11H,7-8,19H2,1-2H3 |
| InChIKey | OJNOPRXONDEWNE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|