C17H19FN2 — CID 103590451
5-fluoro-4-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)aniline (PubChem CID 103590451) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)aniline.
| Compound Name | 5-fluoro-4-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)aniline |
|---|---|
| PubChem CID | 103590451 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-fluoro-4-methyl-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)aniline |
| SMILES | Cc1cc(N2CCc3ccccc3CC2)c(N)cc1F |
| InChI | InChI=1S/C17H19FN2/c1-12-10-17(16(19)11-15(12)18)20-8-6-13-4-2-3-5-14(13)7-9-20/h2-5,10-11H,6-9,19H2,1H3 |
| InChIKey | BMULSQAKBMYHHP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|