About 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid
3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid (PubChem CID 103496505) has the molecular formula C15H10F3NO2
and a molecular weight of 293.24 g/mol. Its IUPAC name is 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid |
| PubChem CID | 103496505 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(N2CCc3ccc(F)cc32)c(F)c1 |
| InChI | InChI=1S/C15H10F3NO2/c16-10-2-1-8-3-4-19(13(8)7-10)14-11(17)5-9(15(20)21)6-12(14)18/h1-2,5-7H,3-4H2,(H,20,21) |
| InChIKey | CRMFOZCWZMQRKH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid?
The IUPAC name of 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid (CID 103496505) is 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid.
What is the SMILES notation for 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid?
The canonical SMILES for 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid is O=C(O)c1cc(F)c(N2CCc3ccc(F)cc32)c(F)c1.
What is the InChIKey of 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid?
The InChIKey is CRMFOZCWZMQRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3NO2/c16-10-2-1-8-3-4-19(13(8)7-10)14-11(17)5-9(15(20)21)6-12(14)18/h1-2,5-7H,3-4H2,(H,20,21).
What are the key properties of 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid?
3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid has a molecular weight of 293.24 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)benzoic acid is sourced from PubChem (CID 103496505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).