C16H13F2NO2 — CID 63537981
4-(3,4-dihydro-2H-quinolin-1-yl)-3,5-difluorobenzoic acid (PubChem CID 63537981) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-3,5-difluorobenzoic acid.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 63537981 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-3,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(N2CCCc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C16H13F2NO2/c17-12-8-11(16(20)21)9-13(18)15(12)19-7-3-5-10-4-1-2-6-14(10)19/h1-2,4,6,8-9H,3,5,7H2,(H,20,21) |
| InChIKey | DZWWFOGQZGFWIN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |