C15H15ClFN3 — CID 103552452
4-chloro-6-(3,4-dihydro-2H-quinolin-1-yl)-5-fluorobenzene-1,3-diamine (PubChem CID 103552452) has the molecular formula C15H15ClFN3 and a molecular weight of 291.76 g/mol. Its IUPAC name is 4-chloro-6-(3,4-dihydro-2H-quinolin-1-yl)-5-fluorobenzene-1,3-diamine.
| Compound Name | 4-chloro-6-(3,4-dihydro-2H-quinolin-1-yl)-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 103552452 |
| Molecular Formula | C15H15ClFN3 |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-chloro-6-(3,4-dihydro-2H-quinolin-1-yl)-5-fluorobenzene-1,3-diamine |
| SMILES | Nc1cc(N)c(N2CCCc3ccccc32)c(F)c1Cl |
| InChI | InChI=1S/C15H15ClFN3/c16-13-10(18)8-11(19)15(14(13)17)20-7-3-5-9-4-1-2-6-12(9)20/h1-2,4,6,8H,3,5,7,18-19H2 |
| InChIKey | ZJUIEQQUQAREHV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|