C13H13ClFN3S — CID 103552446
4-chloro-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorobenzene-1,3-diamine (PubChem CID 103552446) has the molecular formula C13H13ClFN3S and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-chloro-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorobenzene-1,3-diamine.
| Compound Name | 4-chloro-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 103552446 |
| Molecular Formula | C13H13ClFN3S |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-chloro-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-fluorobenzene-1,3-diamine |
| SMILES | Nc1cc(N)c(N2CCc3sccc3C2)c(F)c1Cl |
| InChI | InChI=1S/C13H13ClFN3S/c14-11-8(16)5-9(17)13(12(11)15)18-3-1-10-7(6-18)2-4-19-10/h2,4-5H,1,3,6,16-17H2 |
| InChIKey | NPCNNCALIKZFSU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|