C17H16FNO — CID 29275006
1-[4-(3,4-dihydro-2H-quinolin-1-yl)-3-fluorophenyl]ethanone (PubChem CID 29275006) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-quinolin-1-yl)-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-(3,4-dihydro-2H-quinolin-1-yl)-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 29275006 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-quinolin-1-yl)-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCCc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C17H16FNO/c1-12(20)14-8-9-17(15(18)11-14)19-10-4-6-13-5-2-3-7-16(13)19/h2-3,5,7-9,11H,4,6,10H2,1H3 |
| InChIKey | VUYSCYJEUDIAIL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |