C13H10FNO2S — CID 103497753
4-(6-fluoro-2,3-dihydroindol-1-yl)thiophene-2-carboxylic acid (PubChem CID 103497753) has the molecular formula C13H10FNO2S and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-(6-fluoro-2,3-dihydroindol-1-yl)thiophene-2-carboxylic acid.
| Compound Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103497753 |
| Molecular Formula | C13H10FNO2S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(N2CCc3ccc(F)cc32)cs1 |
| InChI | InChI=1S/C13H10FNO2S/c14-9-2-1-8-3-4-15(11(8)5-9)10-6-12(13(16)17)18-7-10/h1-2,5-7H,3-4H2,(H,16,17) |
| InChIKey | LNXDIGZRUREPNS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |