C12H16N4O4S — CID 115992828
2-amino-3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzenesulfonamide (PubChem CID 115992828) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-amino-3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzenesulfonamide.
| Compound Name | 2-amino-3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115992828 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-amino-3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzenesulfonamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1cccc(S(N)(=O)=O)c1N |
| InChI | InChI=1S/C12H16N4O4S/c1-12(2)11(18)15-9(17)6-16(12)7-4-3-5-8(10(7)13)21(14,19)20/h3-5H,6,13H2,1-2H3,(H2,14,19,20)(H,15,17,18) |
| InChIKey | ASRKHCCCVRNISV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|