C13H16N4O3 — CID 115935224
3-amino-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzamide (PubChem CID 115935224) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-amino-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzamide.
| Compound Name | 3-amino-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 115935224 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-amino-2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)benzamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1c(N)cccc1C(N)=O |
| InChI | InChI=1S/C13H16N4O3/c1-13(2)12(20)16-9(18)6-17(13)10-7(11(15)19)4-3-5-8(10)14/h3-5H,6,14H2,1-2H3,(H2,15,19)(H,16,18,20) |
| InChIKey | MTJJZEHIELZHLM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|