About 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide
3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide (PubChem CID 112579159) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide.
Molecular Properties
| Compound Name | 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide |
| PubChem CID | 112579159 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide |
| SMILES | NC(=O)c1cccc(N)c1N1CCCNC(=O)C1 |
| InChI | InChI=1S/C12H16N4O2/c13-9-4-1-3-8(12(14)18)11(9)16-6-2-5-15-10(17)7-16/h1,3-4H,2,5-7,13H2,(H2,14,18)(H,15,17) |
| InChIKey | BVNVNOVIIFRAHA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide?
The IUPAC name of 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide (CID 112579159) is 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide.
What is the SMILES notation for 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide?
The canonical SMILES for 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide is NC(=O)c1cccc(N)c1N1CCCNC(=O)C1.
What is the InChIKey of 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide?
The InChIKey is BVNVNOVIIFRAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2/c13-9-4-1-3-8(12(14)18)11(9)16-6-2-5-15-10(17)7-16/h1,3-4H,2,5-7,13H2,(H2,14,18)(H,15,17).
What are the key properties of 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide?
3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide has a molecular weight of 248.29 g/mol, XLogP of -0.31, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide is sourced from PubChem (CID 112579159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).