C12H16N4O2 — CID 65363963
5-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide (PubChem CID 65363963) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide.
| Compound Name | 5-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide |
|---|---|
| PubChem CID | 65363963 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-amino-2-(3-oxo-1,4-diazepan-1-yl)benzamide |
| SMILES | NC(=O)c1cc(N)ccc1N1CCCNC(=O)C1 |
| InChI | InChI=1S/C12H16N4O2/c13-8-2-3-10(9(6-8)12(14)18)16-5-1-4-15-11(17)7-16/h2-3,6H,1,4-5,7,13H2,(H2,14,18)(H,15,17) |
| InChIKey | DKWIIPUVBYQXCG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|