C13H15N3O4 — CID 115935225
3-amino-2-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid (PubChem CID 115935225) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-amino-2-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid.
| Compound Name | 3-amino-2-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 115935225 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-amino-2-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid |
| SMILES | CCC1C(=O)NC(=O)CN1c1c(N)cccc1C(=O)O |
| InChI | InChI=1S/C13H15N3O4/c1-2-9-12(18)15-10(17)6-16(9)11-7(13(19)20)4-3-5-8(11)14/h3-5,9H,2,6,14H2,1H3,(H,19,20)(H,15,17,18) |
| InChIKey | GJBRWQRAYPMXTD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|