C15H13N3O3 — CID 115934088
3-amino-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzoic acid (PubChem CID 115934088) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-amino-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzoic acid.
| Compound Name | 3-amino-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 115934088 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-amino-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzoic acid |
| SMILES | Nc1cccc(C(=O)O)c1N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C15H13N3O3/c16-10-5-3-4-9(15(20)21)14(10)18-8-13(19)17-11-6-1-2-7-12(11)18/h1-7H,8,16H2,(H,17,19)(H,20,21) |
| InChIKey | FUDHKAYAXMJURN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|