C16H15N3OS — CID 107928491
5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzenecarbothioamide (PubChem CID 107928491) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzenecarbothioamide.
| Compound Name | 5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107928491 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzenecarbothioamide |
| SMILES | Cc1ccc(N2CC(=O)Nc3ccccc32)c(C(N)=S)c1 |
| InChI | InChI=1S/C16H15N3OS/c1-10-6-7-13(11(8-10)16(17)21)19-9-15(20)18-12-4-2-3-5-14(12)19/h2-8H,9H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | IKBAXQHFFUOFCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|