C16H13FN2O2 — CID 79764947
4-(2-fluoro-4-methylbenzoyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 79764947) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylbenzoyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(2-fluoro-4-methylbenzoyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 79764947 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-(2-fluoro-4-methylbenzoyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | Cc1ccc(C(=O)N2CC(=O)Nc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C16H13FN2O2/c1-10-6-7-11(12(17)8-10)16(21)19-9-15(20)18-13-4-2-3-5-14(13)19/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | BSKWBQWMDOEJEU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |