C16H13N3O — CID 107926990
5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile (PubChem CID 107926990) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile.
| Compound Name | 5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 107926990 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-methyl-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile |
| SMILES | Cc1ccc(N2CC(=O)Nc3ccccc32)c(C#N)c1 |
| InChI | InChI=1S/C16H13N3O/c1-11-6-7-14(12(8-11)9-17)19-10-16(20)18-13-4-2-3-5-15(13)19/h2-8H,10H2,1H3,(H,18,20) |
| InChIKey | BRKYEBQJNXSWIX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |