C15H9F2N3O — CID 107933307
2,3-difluoro-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile (PubChem CID 107933307) has the molecular formula C15H9F2N3O and a molecular weight of 285.25 g/mol. Its IUPAC name is 2,3-difluoro-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile.
| Compound Name | 2,3-difluoro-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 107933307 |
| Molecular Formula | C15H9F2N3O |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2,3-difluoro-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CC(=O)Nc3ccccc32)c(F)c1F |
| InChI | InChI=1S/C15H9F2N3O/c16-14-9(7-18)5-6-12(15(14)17)20-8-13(21)19-10-3-1-2-4-11(10)20/h1-6H,8H2,(H,19,21) |
| InChIKey | OEJDIIIPKVUKCW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |