C14H10N4O — CID 28822354
2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-4-carbonitrile (PubChem CID 28822354) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-4-carbonitrile.
| Compound Name | 2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 28822354 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CC(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C14H10N4O/c15-8-10-5-6-16-13(7-10)18-9-14(19)17-11-3-1-2-4-12(11)18/h1-7H,9H2,(H,17,19) |
| InChIKey | DRTXNRULHLZLDP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |