C14H15N5O — CID 80765124
4-[6-(ethylamino)pyrimidin-4-yl]-1,3-dihydroquinoxalin-2-one (PubChem CID 80765124) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-[6-(ethylamino)pyrimidin-4-yl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[6-(ethylamino)pyrimidin-4-yl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 80765124 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[6-(ethylamino)pyrimidin-4-yl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CCNc1cc(N2CC(=O)Nc3ccccc32)ncn1 |
| InChI | InChI=1S/C14H15N5O/c1-2-15-12-7-13(17-9-16-12)19-8-14(20)18-10-5-3-4-6-11(10)19/h3-7,9H,2,8H2,1H3,(H,18,20)(H,15,16,17) |
| InChIKey | BWLXDPHDPGPDKV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |