C14H14N4O — CID 15894106
4-(4,6-dimethylpyrimidin-2-yl)-1,3-dihydroquinoxalin-2-one (PubChem CID 15894106) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 15894106 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)-1,3-dihydroquinoxalin-2-one |
| SMILES | Cc1cc(C)nc(N2CC(=O)Nc3ccccc32)n1 |
| InChI | InChI=1S/C14H14N4O/c1-9-7-10(2)16-14(15-9)18-8-13(19)17-11-5-3-4-6-12(11)18/h3-7H,8H2,1-2H3,(H,17,19) |
| InChIKey | HWUJFXSHOIOCLP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |