C14H12N4OS — CID 28822400
2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-3-carbothioamide (PubChem CID 28822400) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-3-carbothioamide.
| Compound Name | 2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 28822400 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(3-oxo-2,4-dihydroquinoxalin-1-yl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccnc1N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H12N4OS/c15-13(20)9-4-3-7-16-14(9)18-8-12(19)17-10-5-1-2-6-11(10)18/h1-7H,8H2,(H2,15,20)(H,17,19) |
| InChIKey | OYKQMVMTMQHAMR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|