C14H13N3S — CID 24692134
2-(2,3-dihydroindol-1-yl)pyridine-3-carbothioamide (PubChem CID 24692134) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)pyridine-3-carbothioamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 24692134 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccnc1N1CCc2ccccc21 |
| InChI | InChI=1S/C14H13N3S/c15-13(18)11-5-3-8-16-14(11)17-9-7-10-4-1-2-6-12(10)17/h1-6,8H,7,9H2,(H2,15,18) |
| InChIKey | GSLYJLKFPHWZNR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|