C10H13N3OS — CID 62942859
2-(3-hydroxypyrrolidin-1-yl)pyridine-3-carbothioamide (PubChem CID 62942859) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(3-hydroxypyrrolidin-1-yl)pyridine-3-carbothioamide.
| Compound Name | 2-(3-hydroxypyrrolidin-1-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 62942859 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(3-hydroxypyrrolidin-1-yl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccnc1N1CCC(O)C1 |
| InChI | InChI=1S/C10H13N3OS/c11-9(15)8-2-1-4-12-10(8)13-5-3-7(14)6-13/h1-2,4,7,14H,3,5-6H2,(H2,11,15) |
| InChIKey | JDAGSCXLFJOTDB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|