C11H12N6S — CID 64577343
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-3-carbothioamide (PubChem CID 64577343) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-3-carbothioamide.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 64577343 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccnc1N1CCn2cnnc2C1 |
| InChI | InChI=1S/C11H12N6S/c12-10(18)8-2-1-3-13-11(8)16-4-5-17-7-14-15-9(17)6-16/h1-3,7H,4-6H2,(H2,12,18) |
| InChIKey | PBIRPTWBNBUISV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|