C11H13BrN2OS — CID 107277757
2-bromo-4-(3-hydroxypyrrolidin-1-yl)benzenecarbothioamide (PubChem CID 107277757) has the molecular formula C11H13BrN2OS and a molecular weight of 301.21 g/mol. Its IUPAC name is 2-bromo-4-(3-hydroxypyrrolidin-1-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(3-hydroxypyrrolidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107277757 |
| Molecular Formula | C11H13BrN2OS |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 2-bromo-4-(3-hydroxypyrrolidin-1-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCC(O)C2)cc1Br |
| InChI | InChI=1S/C11H13BrN2OS/c12-10-5-7(1-2-9(10)11(13)16)14-4-3-8(15)6-14/h1-2,5,8,15H,3-4,6H2,(H2,13,16) |
| InChIKey | LQUWYJAZIOWVOE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|