C11H13BrN2S2 — CID 107277311
2-bromo-4-thiomorpholin-4-ylbenzenecarbothioamide (PubChem CID 107277311) has the molecular formula C11H13BrN2S2 and a molecular weight of 317.28 g/mol. Its IUPAC name is 2-bromo-4-thiomorpholin-4-ylbenzenecarbothioamide.
| Compound Name | 2-bromo-4-thiomorpholin-4-ylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107277311 |
| Molecular Formula | C11H13BrN2S2 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-bromo-4-thiomorpholin-4-ylbenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCSCC2)cc1Br |
| InChI | InChI=1S/C11H13BrN2S2/c12-10-7-8(1-2-9(10)11(13)15)14-3-5-16-6-4-14/h1-2,7H,3-6H2,(H2,13,15) |
| InChIKey | DWYALOVBXIDQQY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|