C13H17BrN2S2 — CID 107278137
2-bromo-4-(2,3-dimethylthiomorpholin-4-yl)benzenecarbothioamide (PubChem CID 107278137) has the molecular formula C13H17BrN2S2 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-bromo-4-(2,3-dimethylthiomorpholin-4-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(2,3-dimethylthiomorpholin-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107278137 |
| Molecular Formula | C13H17BrN2S2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-bromo-4-(2,3-dimethylthiomorpholin-4-yl)benzenecarbothioamide |
| SMILES | CC1SCCN(c2ccc(C(N)=S)c(Br)c2)C1C |
| InChI | InChI=1S/C13H17BrN2S2/c1-8-9(2)18-6-5-16(8)10-3-4-11(13(15)17)12(14)7-10/h3-4,7-9H,5-6H2,1-2H3,(H2,15,17) |
| InChIKey | ZLDFVSXCSZFYNJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|