C13H17BrN2OS — CID 107277380
2-bromo-4-(2,5-dimethylmorpholin-4-yl)benzenecarbothioamide (PubChem CID 107277380) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is 2-bromo-4-(2,5-dimethylmorpholin-4-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(2,5-dimethylmorpholin-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107277380 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-bromo-4-(2,5-dimethylmorpholin-4-yl)benzenecarbothioamide |
| SMILES | CC1CN(c2ccc(C(N)=S)c(Br)c2)C(C)CO1 |
| InChI | InChI=1S/C13H17BrN2OS/c1-8-7-17-9(2)6-16(8)10-3-4-11(13(15)18)12(14)5-10/h3-5,8-9H,6-7H2,1-2H3,(H2,15,18) |
| InChIKey | CSDZNIZPDZSJPC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|