C17H17BrN2S — CID 107277783
2-bromo-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarbothioamide (PubChem CID 107277783) has the molecular formula C17H17BrN2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-bromo-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107277783 |
| Molecular Formula | C17H17BrN2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-bromo-4-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCCc3ccccc3C2)cc1Br |
| InChI | InChI=1S/C17H17BrN2S/c18-16-10-14(7-8-15(16)17(19)21)20-9-3-6-12-4-1-2-5-13(12)11-20/h1-2,4-5,7-8,10H,3,6,9,11H2,(H2,19,21) |
| InChIKey | VEEPIAXPWSYCMR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|