C15H13ClN2S — CID 62948137
2-chloro-4-(1,3-dihydroisoindol-2-yl)benzenecarbothioamide (PubChem CID 62948137) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 2-chloro-4-(1,3-dihydroisoindol-2-yl)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(1,3-dihydroisoindol-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 62948137 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-chloro-4-(1,3-dihydroisoindol-2-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2Cc3ccccc3C2)cc1Cl |
| InChI | InChI=1S/C15H13ClN2S/c16-14-7-12(5-6-13(14)15(17)19)18-8-10-3-1-2-4-11(10)9-18/h1-7H,8-9H2,(H2,17,19) |
| InChIKey | KYKISXCUMQPNDL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|