C15H14ClNO — CID 894282
2-(3-chloro-4-methoxyphenyl)-1,3-dihydroisoindole (PubChem CID 894282) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-1,3-dihydroisoindole.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 894282 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-1,3-dihydroisoindole |
| SMILES | COc1ccc(N2Cc3ccccc3C2)cc1Cl |
| InChI | InChI=1S/C15H14ClNO/c1-18-15-7-6-13(8-14(15)16)17-9-11-4-2-3-5-12(11)10-17/h2-8H,9-10H2,1H3 |
| InChIKey | MIKWSOUOBKKUJS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|