C13H16ClNO3 — CID 117022263
1-(3-chloro-4-methoxyphenyl)-2-methylpyrrolidine-3-carboxylic acid (PubChem CID 117022263) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117022263 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-methylpyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(N2CCC(C(=O)O)C2C)cc1Cl |
| InChI | InChI=1S/C13H16ClNO3/c1-8-10(13(16)17)5-6-15(8)9-3-4-12(18-2)11(14)7-9/h3-4,7-8,10H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | RXBLPSINNNOOAM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|