C15H9ClN2O2S — CID 130654578
2-chloro-4-(1,3-dioxoisoindol-2-yl)benzenecarbothioamide (PubChem CID 130654578) has the molecular formula C15H9ClN2O2S and a molecular weight of 316.77 g/mol. Its IUPAC name is 2-chloro-4-(1,3-dioxoisoindol-2-yl)benzenecarbothioamide.
| Compound Name | 2-chloro-4-(1,3-dioxoisoindol-2-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 130654578 |
| Molecular Formula | C15H9ClN2O2S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-chloro-4-(1,3-dioxoisoindol-2-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl |
| InChI | InChI=1S/C15H9ClN2O2S/c16-12-7-8(5-6-11(12)13(17)21)18-14(19)9-3-1-2-4-10(9)15(18)20/h1-7H,(H2,17,21) |
| InChIKey | MXZPABPGWLPRQE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|